C19H26N2O3 — CID 111485178
N-(2-hydroxy-2,5-dimethylhexyl)-2-(2-phenyl-1,3-oxazol-4-yl)acetamide (PubChem CID 111485178) has the molecular formula C19H26N2O3 and a molecular weight of 330.43 g/mol. Its IUPAC name is N-(2-hydroxy-2,5-dimethylhexyl)-2-(2-phenyl-1,3-oxazol-4-yl)acetamide.
| Compound Name | N-(2-hydroxy-2,5-dimethylhexyl)-2-(2-phenyl-1,3-oxazol-4-yl)acetamide |
|---|---|
| PubChem CID | 111485178 |
| Molecular Formula | C19H26N2O3 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | N-(2-hydroxy-2,5-dimethylhexyl)-2-(2-phenyl-1,3-oxazol-4-yl)acetamide |
| SMILES | CC(C)CCC(C)(O)CNC(=O)Cc1coc(-c2ccccc2)n1 |
| InChI | InChI=1S/C19H26N2O3/c1-14(2)9-10-19(3,23)13-20-17(22)11-16-12-24-18(21-16)15-7-5-4-6-8-15/h4-8,12,14,23H,9-11,13H2,1-3H3,(H,20,22) |
| InChIKey | SJOQWULOYIPYMI-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |