C18H24N2O2 — CID 42886686
N-(5-methylhexan-2-yl)-2-(2-phenyl-1,3-oxazol-4-yl)acetamide (PubChem CID 42886686) has the molecular formula C18H24N2O2 and a molecular weight of 300.40 g/mol. Its IUPAC name is N-(5-methylhexan-2-yl)-2-(2-phenyl-1,3-oxazol-4-yl)acetamide.
| Compound Name | N-(5-methylhexan-2-yl)-2-(2-phenyl-1,3-oxazol-4-yl)acetamide |
|---|---|
| PubChem CID | 42886686 |
| Molecular Formula | C18H24N2O2 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | N-(5-methylhexan-2-yl)-2-(2-phenyl-1,3-oxazol-4-yl)acetamide |
| SMILES | CC(C)CCC(C)NC(=O)Cc1coc(-c2ccccc2)n1 |
| InChI | InChI=1S/C18H24N2O2/c1-13(2)9-10-14(3)19-17(21)11-16-12-22-18(20-16)15-7-5-4-6-8-15/h4-8,12-14H,9-11H2,1-3H3,(H,19,21) |
| InChIKey | YOMBNEFXJWXZES-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |