C18H26N4O3 — CID 111485778
N-[(1-hydroxycyclohexyl)methyl]-2-(2,4,6-trimethyl-3-oxo-1H-pyrazolo[3,4-b]pyridin-5-yl)acetamide (PubChem CID 111485778) has the molecular formula C18H26N4O3 and a molecular weight of 346.43 g/mol. Its IUPAC name is N-[(1-hydroxycyclohexyl)methyl]-2-(2,4,6-trimethyl-3-oxo-1H-pyrazolo[3,4-b]pyridin-5-yl)acetamide.
| Compound Name | N-[(1-hydroxycyclohexyl)methyl]-2-(2,4,6-trimethyl-3-oxo-1H-pyrazolo[3,4-b]pyridin-5-yl)acetamide |
|---|---|
| PubChem CID | 111485778 |
| Molecular Formula | C18H26N4O3 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | N-[(1-hydroxycyclohexyl)methyl]-2-(2,4,6-trimethyl-3-oxo-1H-pyrazolo[3,4-b]pyridin-5-yl)acetamide |
| SMILES | Cc1nc2[nH]n(C)c(=O)c2c(C)c1CC(=O)NCC1(O)CCCCC1 |
| InChI | InChI=1S/C18H26N4O3/c1-11-13(12(2)20-16-15(11)17(24)22(3)21-16)9-14(23)19-10-18(25)7-5-4-6-8-18/h25H,4-10H2,1-3H3,(H,19,23)(H,20,21) |
| InChIKey | RUQYWLVSVWXNDE-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 100.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_65_B(7)', 'substructure': 'N/A'} |
|---|