C18H23N3O3 — CID 111485817
N-[(1-hydroxycyclohexyl)methyl]-5-(4-methoxyphenyl)-1H-pyrazole-4-carboxamide (PubChem CID 111485817) has the molecular formula C18H23N3O3 and a molecular weight of 329.40 g/mol. Its IUPAC name is N-[(1-hydroxycyclohexyl)methyl]-5-(4-methoxyphenyl)-1H-pyrazole-4-carboxamide.
| Compound Name | N-[(1-hydroxycyclohexyl)methyl]-5-(4-methoxyphenyl)-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 111485817 |
| Molecular Formula | C18H23N3O3 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | N-[(1-hydroxycyclohexyl)methyl]-5-(4-methoxyphenyl)-1H-pyrazole-4-carboxamide |
| SMILES | COc1ccc(-c2[nH]ncc2C(=O)NCC2(O)CCCCC2)cc1 |
| InChI | InChI=1S/C18H23N3O3/c1-24-14-7-5-13(6-8-14)16-15(11-20-21-16)17(22)19-12-18(23)9-3-2-4-10-18/h5-8,11,23H,2-4,9-10,12H2,1H3,(H,19,22)(H,20,21) |
| InChIKey | UTOLFZYODHMIJY-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 87.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |