C16H18FNO3 — CID 111485827
7-fluoro-N-[(1-hydroxycyclohexyl)methyl]-1-benzofuran-2-carboxamide (PubChem CID 111485827) has the molecular formula C16H18FNO3 and a molecular weight of 291.32 g/mol. Its IUPAC name is 7-fluoro-N-[(1-hydroxycyclohexyl)methyl]-1-benzofuran-2-carboxamide.
| Compound Name | 7-fluoro-N-[(1-hydroxycyclohexyl)methyl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 111485827 |
| Molecular Formula | C16H18FNO3 |
| Molecular Weight | 291.32 g/mol |
| Exact Mass | 291.13 |
| IUPAC Name | 7-fluoro-N-[(1-hydroxycyclohexyl)methyl]-1-benzofuran-2-carboxamide |
| SMILES | O=C(NCC1(O)CCCCC1)c1cc2cccc(F)c2o1 |
| InChI | InChI=1S/C16H18FNO3/c17-12-6-4-5-11-9-13(21-14(11)12)15(19)18-10-16(20)7-2-1-3-8-16/h4-6,9,20H,1-3,7-8,10H2,(H,18,19) |
| InChIKey | AMLKRZXELOPQMK-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.32 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |