C15H16FNO4 — CID 111486301
7-fluoro-N-[(4-hydroxyoxan-4-yl)methyl]-1-benzofuran-2-carboxamide (PubChem CID 111486301) has the molecular formula C15H16FNO4 and a molecular weight of 293.29 g/mol. Its IUPAC name is 7-fluoro-N-[(4-hydroxyoxan-4-yl)methyl]-1-benzofuran-2-carboxamide.
| Compound Name | 7-fluoro-N-[(4-hydroxyoxan-4-yl)methyl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 111486301 |
| Molecular Formula | C15H16FNO4 |
| Molecular Weight | 293.29 g/mol |
| Exact Mass | 293.11 |
| IUPAC Name | 7-fluoro-N-[(4-hydroxyoxan-4-yl)methyl]-1-benzofuran-2-carboxamide |
| SMILES | O=C(NCC1(O)CCOCC1)c1cc2cccc(F)c2o1 |
| InChI | InChI=1S/C15H16FNO4/c16-11-3-1-2-10-8-12(21-13(10)11)14(18)17-9-15(19)4-6-20-7-5-15/h1-3,8,19H,4-7,9H2,(H,17,18) |
| InChIKey | SGKGVJFVUPZXCI-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 71.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.29 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |