C21H20FNO3 — CID 162688811
4-[2-(2-fluorophenyl)ethynyl]-N-[(4-hydroxyoxan-4-yl)methyl]benzamide (PubChem CID 162688811) has the molecular formula C21H20FNO3 and a molecular weight of 353.39 g/mol. Its IUPAC name is 4-[2-(2-fluorophenyl)ethynyl]-N-[(4-hydroxyoxan-4-yl)methyl]benzamide.
| Compound Name | 4-[2-(2-fluorophenyl)ethynyl]-N-[(4-hydroxyoxan-4-yl)methyl]benzamide |
|---|---|
| PubChem CID | 162688811 |
| Molecular Formula | C21H20FNO3 |
| Molecular Weight | 353.39 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | 4-[2-(2-fluorophenyl)ethynyl]-N-[(4-hydroxyoxan-4-yl)methyl]benzamide |
| SMILES | O=C(NCC1(O)CCOCC1)c1ccc(C#Cc2ccccc2F)cc1 |
| InChI | InChI=1S/C21H20FNO3/c22-19-4-2-1-3-17(19)8-5-16-6-9-18(10-7-16)20(24)23-15-21(25)11-13-26-14-12-21/h1-4,6-7,9-10,25H,11-15H2,(H,23,24) |
| InChIKey | QCNDUJKIUPAYCK-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.39 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|