C23H23FN2O3 — CID 162688729
N-[[4-(2-amino-2-oxoethyl)oxan-4-yl]methyl]-4-[2-(2-fluorophenyl)ethynyl]benzamide (PubChem CID 162688729) has the molecular formula C23H23FN2O3 and a molecular weight of 394.45 g/mol. Its IUPAC name is N-[[4-(2-amino-2-oxoethyl)oxan-4-yl]methyl]-4-[2-(2-fluorophenyl)ethynyl]benzamide.
| Compound Name | N-[[4-(2-amino-2-oxoethyl)oxan-4-yl]methyl]-4-[2-(2-fluorophenyl)ethynyl]benzamide |
|---|---|
| PubChem CID | 162688729 |
| Molecular Formula | C23H23FN2O3 |
| Molecular Weight | 394.45 g/mol |
| Exact Mass | 394.17 |
| IUPAC Name | N-[[4-(2-amino-2-oxoethyl)oxan-4-yl]methyl]-4-[2-(2-fluorophenyl)ethynyl]benzamide |
| SMILES | NC(=O)CC1(CNC(=O)c2ccc(C#Cc3ccccc3F)cc2)CCOCC1 |
| InChI | InChI=1S/C23H23FN2O3/c24-20-4-2-1-3-18(20)8-5-17-6-9-19(10-7-17)22(28)26-16-23(15-21(25)27)11-13-29-14-12-23/h1-4,6-7,9-10H,11-16H2,(H2,25,27)(H,26,28) |
| InChIKey | DAARECNOVAUVLC-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.45 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|