C25H28FNO2 — CID 167647348
4-[2-(2-fluorophenyl)ethynyl]-N-[[4-(2-methylpropyl)oxan-4-yl]methyl]benzamide (PubChem CID 167647348) has the molecular formula C25H28FNO2 and a molecular weight of 393.50 g/mol. Its IUPAC name is 4-[2-(2-fluorophenyl)ethynyl]-N-[[4-(2-methylpropyl)oxan-4-yl]methyl]benzamide.
| Compound Name | 4-[2-(2-fluorophenyl)ethynyl]-N-[[4-(2-methylpropyl)oxan-4-yl]methyl]benzamide |
|---|---|
| PubChem CID | 167647348 |
| Molecular Formula | C25H28FNO2 |
| Molecular Weight | 393.50 g/mol |
| Exact Mass | 393.21 |
| IUPAC Name | 4-[2-(2-fluorophenyl)ethynyl]-N-[[4-(2-methylpropyl)oxan-4-yl]methyl]benzamide |
| SMILES | CC(C)CC1(CNC(=O)c2ccc(C#Cc3ccccc3F)cc2)CCOCC1 |
| InChI | InChI=1S/C25H28FNO2/c1-19(2)17-25(13-15-29-16-14-25)18-27-24(28)22-11-8-20(9-12-22)7-10-21-5-3-4-6-23(21)26/h3-6,8-9,11-12,19H,13-18H2,1-2H3,(H,27,28) |
| InChIKey | QBMATNFEZNATHT-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.50 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|