C23H24FNO2 — CID 162688790
4-[2-(2-fluorophenyl)ethynyl]-N-[[1-(hydroxymethyl)cyclohexyl]methyl]benzamide (PubChem CID 162688790) has the molecular formula C23H24FNO2 and a molecular weight of 365.45 g/mol. Its IUPAC name is 4-[2-(2-fluorophenyl)ethynyl]-N-[[1-(hydroxymethyl)cyclohexyl]methyl]benzamide.
| Compound Name | 4-[2-(2-fluorophenyl)ethynyl]-N-[[1-(hydroxymethyl)cyclohexyl]methyl]benzamide |
|---|---|
| PubChem CID | 162688790 |
| Molecular Formula | C23H24FNO2 |
| Molecular Weight | 365.45 g/mol |
| Exact Mass | 365.18 |
| IUPAC Name | 4-[2-(2-fluorophenyl)ethynyl]-N-[[1-(hydroxymethyl)cyclohexyl]methyl]benzamide |
| SMILES | O=C(NCC1(CO)CCCCC1)c1ccc(C#Cc2ccccc2F)cc1 |
| InChI | InChI=1S/C23H24FNO2/c24-21-7-3-2-6-19(21)11-8-18-9-12-20(13-10-18)22(27)25-16-23(17-26)14-4-1-5-15-23/h2-3,6-7,9-10,12-13,26H,1,4-5,14-17H2,(H,25,27) |
| InChIKey | ACWZRBVPDHXTBR-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.45 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|