C42H42F2N2O5 — CID 167587417
4-[2-(2-fluorophenyl)ethynyl]benzoic acid;4-[2-(2-fluorophenyl)ethynyl]-N-(oxan-3-ylmethyl)benzamide;oxan-3-ylmethanamine (PubChem CID 167587417) has the molecular formula C42H42F2N2O5 and a molecular weight of 692.80 g/mol. Its IUPAC name is 4-[2-(2-fluorophenyl)ethynyl]benzoic acid;4-[2-(2-fluorophenyl)ethynyl]-N-(oxan-3-ylmethyl)benzamide;oxan-3-ylmethanamine.
| Compound Name | 4-[2-(2-fluorophenyl)ethynyl]benzoic acid;4-[2-(2-fluorophenyl)ethynyl]-N-(oxan-3-ylmethyl)benzamide;oxan-3-ylmethanamine |
|---|---|
| PubChem CID | 167587417 |
| Molecular Formula | C42H42F2N2O5 |
| Molecular Weight | 692.80 g/mol |
| Exact Mass | 692.31 |
| IUPAC Name | 4-[2-(2-fluorophenyl)ethynyl]benzoic acid;4-[2-(2-fluorophenyl)ethynyl]-N-(oxan-3-ylmethyl)benzamide;oxan-3-ylmethanamine |
| SMILES | NCC1CCCOC1.O=C(NCC1CCCOC1)c1ccc(C#Cc2ccccc2F)cc1.O=C(O)c1ccc(C#Cc2ccccc2F)cc1 |
| InChI | InChI=1S/C21H20FNO2.C15H9FO2.C6H13NO/c22-20-6-2-1-5-18(20)10-7-16-8-11-19(12-9-16)21(24)23-14-17-4-3-13-25-15-17;16-14-4-2-1-3-12(14)8-5-11-6-9-13(10-7-11)15(17)18;7-4-6-2-1-3-8-5-6/h1-2,5-6,8-9,11-12,17H,3-4,13-15H2,(H,23,24);1-4,6-7,9-10H,(H,17,18);6H,1-5,7H2 |
| InChIKey | HZCSFAMUVCVMEF-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 110.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.80 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|