C24H25FN2O2 — CID 164936564
N-[[2-(cyclopropylamino)oxan-4-yl]methyl]-4-[2-(2-fluorophenyl)ethynyl]benzamide (PubChem CID 164936564) has the molecular formula C24H25FN2O2 and a molecular weight of 392.47 g/mol. Its IUPAC name is N-[[2-(cyclopropylamino)oxan-4-yl]methyl]-4-[2-(2-fluorophenyl)ethynyl]benzamide.
| Compound Name | N-[[2-(cyclopropylamino)oxan-4-yl]methyl]-4-[2-(2-fluorophenyl)ethynyl]benzamide |
|---|---|
| PubChem CID | 164936564 |
| Molecular Formula | C24H25FN2O2 |
| Molecular Weight | 392.47 g/mol |
| Exact Mass | 392.19 |
| IUPAC Name | N-[[2-(cyclopropylamino)oxan-4-yl]methyl]-4-[2-(2-fluorophenyl)ethynyl]benzamide |
| SMILES | O=C(NCC1CCOC(NC2CC2)C1)c1ccc(C#Cc2ccccc2F)cc1 |
| InChI | InChI=1S/C24H25FN2O2/c25-22-4-2-1-3-19(22)8-5-17-6-9-20(10-7-17)24(28)26-16-18-13-14-29-23(15-18)27-21-11-12-21/h1-4,6-7,9-10,18,21,23,27H,11-16H2,(H,26,28) |
| InChIKey | DOALPJYIKQAEEH-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.47 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|