C21H21F2NO2 — CID 166960801
4-[2-(6-fluorocyclohexa-1,5-dien-1-yl)ethynyl]-N-[(4-fluorooxan-4-yl)methyl]benzamide (PubChem CID 166960801) has the molecular formula C21H21F2NO2 and a molecular weight of 357.40 g/mol. Its IUPAC name is 4-[2-(6-fluorocyclohexa-1,5-dien-1-yl)ethynyl]-N-[(4-fluorooxan-4-yl)methyl]benzamide.
| Compound Name | 4-[2-(6-fluorocyclohexa-1,5-dien-1-yl)ethynyl]-N-[(4-fluorooxan-4-yl)methyl]benzamide |
|---|---|
| PubChem CID | 166960801 |
| Molecular Formula | C21H21F2NO2 |
| Molecular Weight | 357.40 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | 4-[2-(6-fluorocyclohexa-1,5-dien-1-yl)ethynyl]-N-[(4-fluorooxan-4-yl)methyl]benzamide |
| SMILES | O=C(NCC1(F)CCOCC1)c1ccc(C#CC2=CCCC=C2F)cc1 |
| InChI | InChI=1S/C21H21F2NO2/c22-19-4-2-1-3-17(19)8-5-16-6-9-18(10-7-16)20(25)24-15-21(23)11-13-26-14-12-21/h3-4,6-7,9-10H,1-2,11-15H2,(H,24,25) |
| InChIKey | CZAZYAWZRWMBHY-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.40 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|