C24H24F2N2O — CID 162688806
N-[[1-(cyclopropylamino)cyclopentyl]methyl]-4-[2-(3,4-difluorophenyl)ethynyl]benzamide (PubChem CID 162688806) has the molecular formula C24H24F2N2O and a molecular weight of 394.47 g/mol. Its IUPAC name is N-[[1-(cyclopropylamino)cyclopentyl]methyl]-4-[2-(3,4-difluorophenyl)ethynyl]benzamide.
| Compound Name | N-[[1-(cyclopropylamino)cyclopentyl]methyl]-4-[2-(3,4-difluorophenyl)ethynyl]benzamide |
|---|---|
| PubChem CID | 162688806 |
| Molecular Formula | C24H24F2N2O |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | N-[[1-(cyclopropylamino)cyclopentyl]methyl]-4-[2-(3,4-difluorophenyl)ethynyl]benzamide |
| SMILES | O=C(NCC1(NC2CC2)CCCC1)c1ccc(C#Cc2ccc(F)c(F)c2)cc1 |
| InChI | InChI=1S/C24H24F2N2O/c25-21-12-7-18(15-22(21)26)4-3-17-5-8-19(9-6-17)23(29)27-16-24(13-1-2-14-24)28-20-10-11-20/h5-9,12,15,20,28H,1-2,10-11,13-14,16H2,(H,27,29) |
| InChIKey | ZATRHSWNRGUPSI-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|