C12H18BrNO2S — CID 111485902
2-(5-bromothiophen-2-yl)-N-(2-ethyl-2-hydroxybutyl)acetamide (PubChem CID 111485902) has the molecular formula C12H18BrNO2S and a molecular weight of 320.25 g/mol. Its IUPAC name is 2-(5-bromothiophen-2-yl)-N-(2-ethyl-2-hydroxybutyl)acetamide.
| Compound Name | 2-(5-bromothiophen-2-yl)-N-(2-ethyl-2-hydroxybutyl)acetamide |
|---|---|
| PubChem CID | 111485902 |
| Molecular Formula | C12H18BrNO2S |
| Molecular Weight | 320.25 g/mol |
| Exact Mass | 319.02 |
| IUPAC Name | 2-(5-bromothiophen-2-yl)-N-(2-ethyl-2-hydroxybutyl)acetamide |
| SMILES | CCC(O)(CC)CNC(=O)Cc1ccc(Br)s1 |
| InChI | InChI=1S/C12H18BrNO2S/c1-3-12(16,4-2)8-14-11(15)7-9-5-6-10(13)17-9/h5-6,16H,3-4,7-8H2,1-2H3,(H,14,15) |
| InChIKey | JEAMFSVWUUQMBJ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.25 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |