C11H18N2OS — CID 119626700
N-(2-amino-2-methylpropyl)-2-(5-methylthiophen-2-yl)acetamide (PubChem CID 119626700) has the molecular formula C11H18N2OS and a molecular weight of 226.34 g/mol. Its IUPAC name is N-(2-amino-2-methylpropyl)-2-(5-methylthiophen-2-yl)acetamide.
| Compound Name | N-(2-amino-2-methylpropyl)-2-(5-methylthiophen-2-yl)acetamide |
|---|---|
| PubChem CID | 119626700 |
| Molecular Formula | C11H18N2OS |
| Molecular Weight | 226.34 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | N-(2-amino-2-methylpropyl)-2-(5-methylthiophen-2-yl)acetamide |
| SMILES | Cc1ccc(CC(=O)NCC(C)(C)N)s1 |
| InChI | InChI=1S/C11H18N2OS/c1-8-4-5-9(15-8)6-10(14)13-7-11(2,3)12/h4-5H,6-7,12H2,1-3H3,(H,13,14) |
| InChIKey | QUMWQSFIBMCKEB-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.34 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |