C10H15ClN2OS — CID 130693929
N-(2-aminocyclopropyl)-2-(5-methylthiophen-2-yl)acetamide;hydrochloride (PubChem CID 130693929) has the molecular formula C10H15ClN2OS and a molecular weight of 246.76 g/mol. Its IUPAC name is N-(2-aminocyclopropyl)-2-(5-methylthiophen-2-yl)acetamide;hydrochloride.
| Compound Name | N-(2-aminocyclopropyl)-2-(5-methylthiophen-2-yl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 130693929 |
| Molecular Formula | C10H15ClN2OS |
| Molecular Weight | 246.76 g/mol |
| Exact Mass | 246.06 |
| IUPAC Name | N-(2-aminocyclopropyl)-2-(5-methylthiophen-2-yl)acetamide;hydrochloride |
| SMILES | Cc1ccc(CC(=O)NC2CC2N)s1.Cl |
| InChI | InChI=1S/C10H14N2OS.ClH/c1-6-2-3-7(14-6)4-10(13)12-9-5-8(9)11;/h2-3,8-9H,4-5,11H2,1H3,(H,12,13);1H |
| InChIKey | XNFVNMFEGWCEAD-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.76 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |