About N-(2-aminocyclopropyl)-2-(5-methyl-1,2-oxazol-3-yl)acetamide
N-(2-aminocyclopropyl)-2-(5-methyl-1,2-oxazol-3-yl)acetamide (PubChem CID 83619555) has the molecular formula C9H13N3O2
and a molecular weight of 195.22 g/mol. Its IUPAC name is N-(2-aminocyclopropyl)-2-(5-methyl-1,2-oxazol-3-yl)acetamide.
Molecular Properties
| Compound Name | N-(2-aminocyclopropyl)-2-(5-methyl-1,2-oxazol-3-yl)acetamide |
| PubChem CID | 83619555 |
| Molecular Formula | C9H13N3O2 |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.10 |
| IUPAC Name | N-(2-aminocyclopropyl)-2-(5-methyl-1,2-oxazol-3-yl)acetamide |
| SMILES | Cc1cc(CC(=O)NC2CC2N)no1 |
| InChI | InChI=1S/C9H13N3O2/c1-5-2-6(12-14-5)3-9(13)11-8-4-7(8)10/h2,7-8H,3-4,10H2,1H3,(H,11,13) |
| InChIKey | LAGRPUDZWRXJQP-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(2-aminocyclopropyl)-2-(5-methyl-1,2-oxazol-3-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-aminocyclopropyl)-2-(5-methyl-1,2-oxazol-3-yl)acetamide?
The IUPAC name of N-(2-aminocyclopropyl)-2-(5-methyl-1,2-oxazol-3-yl)acetamide (CID 83619555) is N-(2-aminocyclopropyl)-2-(5-methyl-1,2-oxazol-3-yl)acetamide.
What is the SMILES notation for N-(2-aminocyclopropyl)-2-(5-methyl-1,2-oxazol-3-yl)acetamide?
The canonical SMILES for N-(2-aminocyclopropyl)-2-(5-methyl-1,2-oxazol-3-yl)acetamide is Cc1cc(CC(=O)NC2CC2N)no1.
What is the InChIKey of N-(2-aminocyclopropyl)-2-(5-methyl-1,2-oxazol-3-yl)acetamide?
The InChIKey is LAGRPUDZWRXJQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N3O2/c1-5-2-6(12-14-5)3-9(13)11-8-4-7(8)10/h2,7-8H,3-4,10H2,1H3,(H,11,13).
What are the key properties of N-(2-aminocyclopropyl)-2-(5-methyl-1,2-oxazol-3-yl)acetamide?
N-(2-aminocyclopropyl)-2-(5-methyl-1,2-oxazol-3-yl)acetamide has a molecular weight of 195.22 g/mol, XLogP of -0.26, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-aminocyclopropyl)-2-(5-methyl-1,2-oxazol-3-yl)acetamide is sourced from PubChem (CID 83619555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).