C18H22N2O2 — CID 95964657
2-(5-methyl-1,2-oxazol-3-yl)-N-[(1R,2S)-2-phenylcyclohexyl]acetamide (PubChem CID 95964657) has the molecular formula C18H22N2O2 and a molecular weight of 298.39 g/mol. Its IUPAC name is 2-(5-methyl-1,2-oxazol-3-yl)-N-[(1R,2S)-2-phenylcyclohexyl]acetamide.
| Compound Name | 2-(5-methyl-1,2-oxazol-3-yl)-N-[(1R,2S)-2-phenylcyclohexyl]acetamide |
|---|---|
| PubChem CID | 95964657 |
| Molecular Formula | C18H22N2O2 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | 2-(5-methyl-1,2-oxazol-3-yl)-N-[(1R,2S)-2-phenylcyclohexyl]acetamide |
| SMILES | Cc1cc(CC(=O)N[C@@H]2CCCC[C@H]2c2ccccc2)no1 |
| InChI | InChI=1S/C18H22N2O2/c1-13-11-15(20-22-13)12-18(21)19-17-10-6-5-9-16(17)14-7-3-2-4-8-14/h2-4,7-8,11,16-17H,5-6,9-10,12H2,1H3,(H,19,21)/t16-,17+/m0/s1 |
| InChIKey | UQAKYCVGZNVVDI-DLBZAZTESA-N |
| XLogP | 3.37 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |