About N-[2-(aminomethyl)cyclohexyl]-2-(5-methyl-1,2-oxazol-3-yl)acetamide
N-[2-(aminomethyl)cyclohexyl]-2-(5-methyl-1,2-oxazol-3-yl)acetamide (PubChem CID 119609935) has the molecular formula C13H21N3O2
and a molecular weight of 251.33 g/mol. Its IUPAC name is N-[2-(aminomethyl)cyclohexyl]-2-(5-methyl-1,2-oxazol-3-yl)acetamide.
Molecular Properties
| Compound Name | N-[2-(aminomethyl)cyclohexyl]-2-(5-methyl-1,2-oxazol-3-yl)acetamide |
| PubChem CID | 119609935 |
| Molecular Formula | C13H21N3O2 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.16 |
| IUPAC Name | N-[2-(aminomethyl)cyclohexyl]-2-(5-methyl-1,2-oxazol-3-yl)acetamide |
| SMILES | Cc1cc(CC(=O)NC2CCCCC2CN)no1 |
| InChI | InChI=1S/C13H21N3O2/c1-9-6-11(16-18-9)7-13(17)15-12-5-3-2-4-10(12)8-14/h6,10,12H,2-5,7-8,14H2,1H3,(H,15,17) |
| InChIKey | YFMBBXJMVXASDZ-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[2-(aminomethyl)cyclohexyl]-2-(5-methyl-1,2-oxazol-3-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(aminomethyl)cyclohexyl]-2-(5-methyl-1,2-oxazol-3-yl)acetamide?
The IUPAC name of N-[2-(aminomethyl)cyclohexyl]-2-(5-methyl-1,2-oxazol-3-yl)acetamide (CID 119609935) is N-[2-(aminomethyl)cyclohexyl]-2-(5-methyl-1,2-oxazol-3-yl)acetamide.
What is the SMILES notation for N-[2-(aminomethyl)cyclohexyl]-2-(5-methyl-1,2-oxazol-3-yl)acetamide?
The canonical SMILES for N-[2-(aminomethyl)cyclohexyl]-2-(5-methyl-1,2-oxazol-3-yl)acetamide is Cc1cc(CC(=O)NC2CCCCC2CN)no1.
What is the InChIKey of N-[2-(aminomethyl)cyclohexyl]-2-(5-methyl-1,2-oxazol-3-yl)acetamide?
The InChIKey is YFMBBXJMVXASDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21N3O2/c1-9-6-11(16-18-9)7-13(17)15-12-5-3-2-4-10(12)8-14/h6,10,12H,2-5,7-8,14H2,1H3,(H,15,17).
What are the key properties of N-[2-(aminomethyl)cyclohexyl]-2-(5-methyl-1,2-oxazol-3-yl)acetamide?
N-[2-(aminomethyl)cyclohexyl]-2-(5-methyl-1,2-oxazol-3-yl)acetamide has a molecular weight of 251.33 g/mol, XLogP of 1.16, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(aminomethyl)cyclohexyl]-2-(5-methyl-1,2-oxazol-3-yl)acetamide is sourced from PubChem (CID 119609935), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).