About 2-[[1-(2,6-dimethylphenyl)tetrazol-5-yl]methyl-(2-hydroxyethyl)amino]ethanol
2-[[1-(2,6-dimethylphenyl)tetrazol-5-yl]methyl-(2-hydroxyethyl)amino]ethanol (PubChem CID 111487800) has the molecular formula C14H21N5O2
and a molecular weight of 291.36 g/mol. Its IUPAC name is 2-[[1-(2,6-dimethylphenyl)tetrazol-5-yl]methyl-(2-hydroxyethyl)amino]ethanol.
Molecular Properties
| Compound Name | 2-[[1-(2,6-dimethylphenyl)tetrazol-5-yl]methyl-(2-hydroxyethyl)amino]ethanol |
| PubChem CID | 111487800 |
| Molecular Formula | C14H21N5O2 |
| Molecular Weight | 291.36 g/mol |
| Exact Mass | 291.17 |
| IUPAC Name | 2-[[1-(2,6-dimethylphenyl)tetrazol-5-yl]methyl-(2-hydroxyethyl)amino]ethanol |
| SMILES | Cc1cccc(C)c1-n1nnnc1CN(CCO)CCO |
| InChI | InChI=1S/C14H21N5O2/c1-11-4-3-5-12(2)14(11)19-13(15-16-17-19)10-18(6-8-20)7-9-21/h3-5,20-21H,6-10H2,1-2H3 |
| InChIKey | ZQTCWNYAYVWSSX-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.36 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-[[1-(2,6-dimethylphenyl)tetrazol-5-yl]methyl-(2-hydroxyethyl)amino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[1-(2,6-dimethylphenyl)tetrazol-5-yl]methyl-(2-hydroxyethyl)amino]ethanol?
The IUPAC name of 2-[[1-(2,6-dimethylphenyl)tetrazol-5-yl]methyl-(2-hydroxyethyl)amino]ethanol (CID 111487800) is 2-[[1-(2,6-dimethylphenyl)tetrazol-5-yl]methyl-(2-hydroxyethyl)amino]ethanol.
What is the SMILES notation for 2-[[1-(2,6-dimethylphenyl)tetrazol-5-yl]methyl-(2-hydroxyethyl)amino]ethanol?
The canonical SMILES for 2-[[1-(2,6-dimethylphenyl)tetrazol-5-yl]methyl-(2-hydroxyethyl)amino]ethanol is Cc1cccc(C)c1-n1nnnc1CN(CCO)CCO.
What is the InChIKey of 2-[[1-(2,6-dimethylphenyl)tetrazol-5-yl]methyl-(2-hydroxyethyl)amino]ethanol?
The InChIKey is ZQTCWNYAYVWSSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21N5O2/c1-11-4-3-5-12(2)14(11)19-13(15-16-17-19)10-18(6-8-20)7-9-21/h3-5,20-21H,6-10H2,1-2H3.
What are the key properties of 2-[[1-(2,6-dimethylphenyl)tetrazol-5-yl]methyl-(2-hydroxyethyl)amino]ethanol?
2-[[1-(2,6-dimethylphenyl)tetrazol-5-yl]methyl-(2-hydroxyethyl)amino]ethanol has a molecular weight of 291.36 g/mol, XLogP of 0.07, 7 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[1-(2,6-dimethylphenyl)tetrazol-5-yl]methyl-(2-hydroxyethyl)amino]ethanol is sourced from PubChem (CID 111487800), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).