C15H23BrN2O2 — CID 111488423
N-[(2-bromophenyl)methyl]-2-[3-hydroxybutyl(methyl)amino]-N-methylacetamide (PubChem CID 111488423) has the molecular formula C15H23BrN2O2 and a molecular weight of 343.26 g/mol. Its IUPAC name is N-[(2-bromophenyl)methyl]-2-[3-hydroxybutyl(methyl)amino]-N-methylacetamide.
| Compound Name | N-[(2-bromophenyl)methyl]-2-[3-hydroxybutyl(methyl)amino]-N-methylacetamide |
|---|---|
| PubChem CID | 111488423 |
| Molecular Formula | C15H23BrN2O2 |
| Molecular Weight | 343.26 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | N-[(2-bromophenyl)methyl]-2-[3-hydroxybutyl(methyl)amino]-N-methylacetamide |
| SMILES | CC(O)CCN(C)CC(=O)N(C)Cc1ccccc1Br |
| InChI | InChI=1S/C15H23BrN2O2/c1-12(19)8-9-17(2)11-15(20)18(3)10-13-6-4-5-7-14(13)16/h4-7,12,19H,8-11H2,1-3H3 |
| InChIKey | DMZCAFNXJYWYPR-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.26 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |