C13H18BrNO — CID 60630959
N-[(2-bromophenyl)methyl]-N,3-dimethylbutanamide (PubChem CID 60630959) has the molecular formula C13H18BrNO and a molecular weight of 284.20 g/mol. Its IUPAC name is N-[(2-bromophenyl)methyl]-N,3-dimethylbutanamide.
| Compound Name | N-[(2-bromophenyl)methyl]-N,3-dimethylbutanamide |
|---|---|
| PubChem CID | 60630959 |
| Molecular Formula | C13H18BrNO |
| Molecular Weight | 284.20 g/mol |
| Exact Mass | 283.06 |
| IUPAC Name | N-[(2-bromophenyl)methyl]-N,3-dimethylbutanamide |
| SMILES | CC(C)CC(=O)N(C)Cc1ccccc1Br |
| InChI | InChI=1S/C13H18BrNO/c1-10(2)8-13(16)15(3)9-11-6-4-5-7-12(11)14/h4-7,10H,8-9H2,1-3H3 |
| InChIKey | LIPKMXIRRDSVDY-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.20 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |