C13H21NO4 — CID 111488799
methyl 5-[[3-hydroxybutyl(methyl)amino]methyl]-3-methylfuran-2-carboxylate (PubChem CID 111488799) has the molecular formula C13H21NO4 and a molecular weight of 255.31 g/mol. Its IUPAC name is methyl 5-[[3-hydroxybutyl(methyl)amino]methyl]-3-methylfuran-2-carboxylate.
| Compound Name | methyl 5-[[3-hydroxybutyl(methyl)amino]methyl]-3-methylfuran-2-carboxylate |
|---|---|
| PubChem CID | 111488799 |
| Molecular Formula | C13H21NO4 |
| Molecular Weight | 255.31 g/mol |
| Exact Mass | 255.15 |
| IUPAC Name | methyl 5-[[3-hydroxybutyl(methyl)amino]methyl]-3-methylfuran-2-carboxylate |
| SMILES | COC(=O)c1oc(CN(C)CCC(C)O)cc1C |
| InChI | InChI=1S/C13H21NO4/c1-9-7-11(18-12(9)13(16)17-4)8-14(3)6-5-10(2)15/h7,10,15H,5-6,8H2,1-4H3 |
| InChIKey | CPPWZQXNSBVORS-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 62.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.31 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |