C17H21NO4 — CID 111859973
methyl 5-[[N-(3-hydroxypropyl)anilino]methyl]-3-methylfuran-2-carboxylate (PubChem CID 111859973) has the molecular formula C17H21NO4 and a molecular weight of 303.36 g/mol. Its IUPAC name is methyl 5-[[N-(3-hydroxypropyl)anilino]methyl]-3-methylfuran-2-carboxylate.
| Compound Name | methyl 5-[[N-(3-hydroxypropyl)anilino]methyl]-3-methylfuran-2-carboxylate |
|---|---|
| PubChem CID | 111859973 |
| Molecular Formula | C17H21NO4 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | methyl 5-[[N-(3-hydroxypropyl)anilino]methyl]-3-methylfuran-2-carboxylate |
| SMILES | COC(=O)c1oc(CN(CCCO)c2ccccc2)cc1C |
| InChI | InChI=1S/C17H21NO4/c1-13-11-15(22-16(13)17(20)21-2)12-18(9-6-10-19)14-7-4-3-5-8-14/h3-5,7-8,11,19H,6,9-10,12H2,1-2H3 |
| InChIKey | HTTJBMPMRUXXHG-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 62.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |