C13H23F3N2O2 — CID 111489348
1-(5-hydroxypentyl)-N-(2,2,2-trifluoroethyl)piperidine-3-carboxamide (PubChem CID 111489348) has the molecular formula C13H23F3N2O2 and a molecular weight of 296.33 g/mol. Its IUPAC name is 1-(5-hydroxypentyl)-N-(2,2,2-trifluoroethyl)piperidine-3-carboxamide.
| Compound Name | 1-(5-hydroxypentyl)-N-(2,2,2-trifluoroethyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 111489348 |
| Molecular Formula | C13H23F3N2O2 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | 1-(5-hydroxypentyl)-N-(2,2,2-trifluoroethyl)piperidine-3-carboxamide |
| SMILES | O=C(NCC(F)(F)F)C1CCCN(CCCCCO)C1 |
| InChI | InChI=1S/C13H23F3N2O2/c14-13(15,16)10-17-12(20)11-5-4-7-18(9-11)6-2-1-3-8-19/h11,19H,1-10H2,(H,17,20) |
| InChIKey | JYJXGDNYEIDEEI-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|