C14H26F2N2O2V — CID 154670292
N-[3,3-difluoro-1-(5-hydroxypentyl)piperidin-4-yl]-2-methylpropanamide;vanadium (PubChem CID 154670292) has the molecular formula C14H26F2N2O2V and a molecular weight of 343.31 g/mol. Its IUPAC name is N-[3,3-difluoro-1-(5-hydroxypentyl)piperidin-4-yl]-2-methylpropanamide;vanadium.
| Compound Name | N-[3,3-difluoro-1-(5-hydroxypentyl)piperidin-4-yl]-2-methylpropanamide;vanadium |
|---|---|
| PubChem CID | 154670292 |
| Molecular Formula | C14H26F2N2O2V |
| Molecular Weight | 343.31 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | N-[3,3-difluoro-1-(5-hydroxypentyl)piperidin-4-yl]-2-methylpropanamide;vanadium |
| SMILES | CC(C)C(=O)NC1CCN(CCCCCO)CC1(F)F.[V] |
| InChI | InChI=1S/C14H26F2N2O2.V/c1-11(2)13(20)17-12-6-8-18(10-14(12,15)16)7-4-3-5-9-19;/h11-12,19H,3-10H2,1-2H3,(H,17,20); |
| InChIKey | GGLUJPHGDIYAFO-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.31 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|