C16H31FN2O2 — CID 154670228
N-[1-(5-ethoxypentyl)-3-fluoropiperidin-4-yl]-2-methylpropanamide (PubChem CID 154670228) has the molecular formula C16H31FN2O2 and a molecular weight of 302.43 g/mol. Its IUPAC name is N-[1-(5-ethoxypentyl)-3-fluoropiperidin-4-yl]-2-methylpropanamide.
| Compound Name | N-[1-(5-ethoxypentyl)-3-fluoropiperidin-4-yl]-2-methylpropanamide |
|---|---|
| PubChem CID | 154670228 |
| Molecular Formula | C16H31FN2O2 |
| Molecular Weight | 302.43 g/mol |
| Exact Mass | 302.24 |
| IUPAC Name | N-[1-(5-ethoxypentyl)-3-fluoropiperidin-4-yl]-2-methylpropanamide |
| SMILES | CCOCCCCCN1CCC(NC(=O)C(C)C)C(F)C1 |
| InChI | InChI=1S/C16H31FN2O2/c1-4-21-11-7-5-6-9-19-10-8-15(14(17)12-19)18-16(20)13(2)3/h13-15H,4-12H2,1-3H3,(H,18,20) |
| InChIKey | BAHBNOXDIXQNSJ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.43 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|