C16H30F2N2O2 — CID 166466836
N-[1-(5-ethoxypentyl)-3,3-difluoropiperidin-4-yl]-2-methylpropanamide (PubChem CID 166466836) has the molecular formula C16H30F2N2O2 and a molecular weight of 320.42 g/mol. Its IUPAC name is N-[1-(5-ethoxypentyl)-3,3-difluoropiperidin-4-yl]-2-methylpropanamide.
| Compound Name | N-[1-(5-ethoxypentyl)-3,3-difluoropiperidin-4-yl]-2-methylpropanamide |
|---|---|
| PubChem CID | 166466836 |
| Molecular Formula | C16H30F2N2O2 |
| Molecular Weight | 320.42 g/mol |
| Exact Mass | 320.23 |
| IUPAC Name | N-[1-(5-ethoxypentyl)-3,3-difluoropiperidin-4-yl]-2-methylpropanamide |
| SMILES | CCOCCCCCN1CCC(NC(=O)C(C)C)C(F)(F)C1 |
| InChI | InChI=1S/C16H30F2N2O2/c1-4-22-11-7-5-6-9-20-10-8-14(16(17,18)12-20)19-15(21)13(2)3/h13-14H,4-12H2,1-3H3,(H,19,21) |
| InChIKey | SMTUSSVGKJDRGA-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.42 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|