C14H13F2NO — CID 111490393
2-[bis(prop-2-ynyl)amino]-1-(2,4-difluorophenyl)ethanol (PubChem CID 111490393) has the molecular formula C14H13F2NO and a molecular weight of 249.26 g/mol. Its IUPAC name is 2-[bis(prop-2-ynyl)amino]-1-(2,4-difluorophenyl)ethanol.
| Compound Name | 2-[bis(prop-2-ynyl)amino]-1-(2,4-difluorophenyl)ethanol |
|---|---|
| PubChem CID | 111490393 |
| Molecular Formula | C14H13F2NO |
| Molecular Weight | 249.26 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | 2-[bis(prop-2-ynyl)amino]-1-(2,4-difluorophenyl)ethanol |
| SMILES | C#CCN(CC#C)CC(O)c1ccc(F)cc1F |
| InChI | InChI=1S/C14H13F2NO/c1-3-7-17(8-4-2)10-14(18)12-6-5-11(15)9-13(12)16/h1-2,5-6,9,14,18H,7-8,10H2 |
| InChIKey | LDAYAFXDPLTTEW-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.26 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|