C23H27N3O2 — CID 111491490
1-ethyl-2-(furan-2-ylmethyl)-3-(2-hydroxy-2,3-diphenylpropyl)guanidine (PubChem CID 111491490) has the molecular formula C23H27N3O2 and a molecular weight of 377.49 g/mol. Its IUPAC name is 1-ethyl-2-(furan-2-ylmethyl)-3-(2-hydroxy-2,3-diphenylpropyl)guanidine.
| Compound Name | 1-ethyl-2-(furan-2-ylmethyl)-3-(2-hydroxy-2,3-diphenylpropyl)guanidine |
|---|---|
| PubChem CID | 111491490 |
| Molecular Formula | C23H27N3O2 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.21 |
| IUPAC Name | 1-ethyl-2-(furan-2-ylmethyl)-3-(2-hydroxy-2,3-diphenylpropyl)guanidine |
| SMILES | CCN/C(=N\Cc1ccco1)NCC(O)(Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H27N3O2/c1-2-24-22(25-17-21-14-9-15-28-21)26-18-23(27,20-12-7-4-8-13-20)16-19-10-5-3-6-11-19/h3-15,27H,2,16-18H2,1H3,(H2,24,25,26) |
| InChIKey | BJHIDJABMDQWCZ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 69.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|