C15H25IN4OS — CID 111493971
2-methyl-1-[(4-methylsulfanyloxan-4-yl)methyl]-3-(pyridin-2-ylmethyl)guanidine;hydroiodide (PubChem CID 111493971) has the molecular formula C15H25IN4OS and a molecular weight of 436.36 g/mol. Its IUPAC name is 2-methyl-1-[(4-methylsulfanyloxan-4-yl)methyl]-3-(pyridin-2-ylmethyl)guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[(4-methylsulfanyloxan-4-yl)methyl]-3-(pyridin-2-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111493971 |
| Molecular Formula | C15H25IN4OS |
| Molecular Weight | 436.36 g/mol |
| Exact Mass | 436.08 |
| IUPAC Name | 2-methyl-1-[(4-methylsulfanyloxan-4-yl)methyl]-3-(pyridin-2-ylmethyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1ccccn1)NCC1(SC)CCOCC1.I |
| InChI | InChI=1S/C15H24N4OS.HI/c1-16-14(18-11-13-5-3-4-8-17-13)19-12-15(21-2)6-9-20-10-7-15;/h3-5,8H,6-7,9-12H2,1-2H3,(H2,16,18,19);1H |
| InChIKey | FIXJTPOJXIUOLG-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 58.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.36 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|