C15H24O3 — CID 11149431
(1aS,4aS,5S,8aR)-4-(hydroxymethyl)-3,4a,8,8-tetramethyl-2,5,6,7-tetrahydro-1aH-naphtho[4a,5-b]oxiren-5-ol (PubChem CID 11149431) has the molecular formula C15H24O3 and a molecular weight of 252.35 g/mol. Its IUPAC name is (1aS,4aS,5S,8aR)-4-(hydroxymethyl)-3,4a,8,8-tetramethyl-2,5,6,7-tetrahydro-1aH-naphtho[4a,5-b]oxiren-5-ol.
| Compound Name | (1aS,4aS,5S,8aR)-4-(hydroxymethyl)-3,4a,8,8-tetramethyl-2,5,6,7-tetrahydro-1aH-naphtho[4a,5-b]oxiren-5-ol |
|---|---|
| PubChem CID | 11149431 |
| Molecular Formula | C15H24O3 |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | (1aS,4aS,5S,8aR)-4-(hydroxymethyl)-3,4a,8,8-tetramethyl-2,5,6,7-tetrahydro-1aH-naphtho[4a,5-b]oxiren-5-ol |
| SMILES | CC1=C(CO)[C@@]2(C)[C@@H](O)CCC(C)(C)[C@@]23O[C@H]3C1 |
| InChI | InChI=1S/C15H24O3/c1-9-7-12-15(18-12)13(2,3)6-5-11(17)14(15,4)10(9)8-16/h11-12,16-17H,5-8H2,1-4H3/t11-,12-,14-,15+/m0/s1 |
| InChIKey | ZDRXOAMLSXOBFQ-NZBPQXDJSA-N |
| XLogP | 2.02 |
| TPSA | 52.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|