C12H18O3 — CID 11333297
(1aR,4aS,5R,8aS)-4a-(methoxymethyl)-1a,2,5,6,7,8-hexahydronaphtho[4a,5-b]oxiren-5-ol (PubChem CID 11333297) has the molecular formula C12H18O3 and a molecular weight of 210.27 g/mol. Its IUPAC name is (1aR,4aS,5R,8aS)-4a-(methoxymethyl)-1a,2,5,6,7,8-hexahydronaphtho[4a,5-b]oxiren-5-ol.
| Compound Name | (1aR,4aS,5R,8aS)-4a-(methoxymethyl)-1a,2,5,6,7,8-hexahydronaphtho[4a,5-b]oxiren-5-ol |
|---|---|
| PubChem CID | 11333297 |
| Molecular Formula | C12H18O3 |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | (1aR,4aS,5R,8aS)-4a-(methoxymethyl)-1a,2,5,6,7,8-hexahydronaphtho[4a,5-b]oxiren-5-ol |
| SMILES | COC[C@]12C=CC[C@H]3O[C@]31CCC[C@H]2O |
| InChI | InChI=1S/C12H18O3/c1-14-8-11-6-3-5-10-12(11,15-10)7-2-4-9(11)13/h3,6,9-10,13H,2,4-5,7-8H2,1H3/t9-,10-,11+,12-/m1/s1 |
| InChIKey | UQXWUMNDMWNEQJ-WISYIIOYSA-N |
| XLogP | 1.26 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|