C13H20O2 — CID 164676202
(1S,2R,4S,6R,10R)-1,4,6,8-tetramethyl-3-oxatricyclo[4.3.1.02,4]dec-7-en-10-ol (PubChem CID 164676202) has the molecular formula C13H20O2 and a molecular weight of 208.30 g/mol. Its IUPAC name is (1S,2R,4S,6R,10R)-1,4,6,8-tetramethyl-3-oxatricyclo[4.3.1.02,4]dec-7-en-10-ol.
| Compound Name | (1S,2R,4S,6R,10R)-1,4,6,8-tetramethyl-3-oxatricyclo[4.3.1.02,4]dec-7-en-10-ol |
|---|---|
| PubChem CID | 164676202 |
| Molecular Formula | C13H20O2 |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.15 |
| IUPAC Name | (1S,2R,4S,6R,10R)-1,4,6,8-tetramethyl-3-oxatricyclo[4.3.1.02,4]dec-7-en-10-ol |
| SMILES | CC1=C[C@@]2(C)C[C@]3(C)O[C@@H]3[C@@](C)(C1)[C@@H]2O |
| InChI | InChI=1S/C13H20O2/c1-8-5-11(2)7-13(4)10(15-13)12(3,6-8)9(11)14/h5,9-10,14H,6-7H2,1-4H3/t9-,10-,11+,12+,13+/m1/s1 |
| InChIKey | QWOLFNDLPYNSPS-BNDIWNMDSA-N |
| XLogP | 2.27 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|