C15H25FO3 — CID 123765383
1-(6-fluoro-5-methoxy-1-oxaspiro[2.5]octan-4-yl)-5-methylhex-4-en-2-ol (PubChem CID 123765383) has the molecular formula C15H25FO3 and a molecular weight of 272.36 g/mol. Its IUPAC name is 1-(6-fluoro-5-methoxy-1-oxaspiro[2.5]octan-4-yl)-5-methylhex-4-en-2-ol.
| Compound Name | 1-(6-fluoro-5-methoxy-1-oxaspiro[2.5]octan-4-yl)-5-methylhex-4-en-2-ol |
|---|---|
| PubChem CID | 123765383 |
| Molecular Formula | C15H25FO3 |
| Molecular Weight | 272.36 g/mol |
| Exact Mass | 272.18 |
| IUPAC Name | 1-(6-fluoro-5-methoxy-1-oxaspiro[2.5]octan-4-yl)-5-methylhex-4-en-2-ol |
| SMILES | COC1C(F)CCC2(CO2)C1CC(O)CC=C(C)C |
| InChI | InChI=1S/C15H25FO3/c1-10(2)4-5-11(17)8-12-14(18-3)13(16)6-7-15(12)9-19-15/h4,11-14,17H,5-9H2,1-3H3 |
| InChIKey | VTCVSBMSUSSDBX-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.36 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|