C16H24F2O3 — CID 123313953
6,6-difluoro-5-methoxy-4-[2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octane (PubChem CID 123313953) has the molecular formula C16H24F2O3 and a molecular weight of 302.36 g/mol. Its IUPAC name is 6,6-difluoro-5-methoxy-4-[2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octane.
| Compound Name | 6,6-difluoro-5-methoxy-4-[2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octane |
|---|---|
| PubChem CID | 123313953 |
| Molecular Formula | C16H24F2O3 |
| Molecular Weight | 302.36 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | 6,6-difluoro-5-methoxy-4-[2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octane |
| SMILES | COC1C(C2(C)OC2CC=C(C)C)C2(CCC1(F)F)CO2 |
| InChI | InChI=1S/C16H24F2O3/c1-10(2)5-6-11-14(3,21-11)12-13(19-4)16(17,18)8-7-15(12)9-20-15/h5,11-13H,6-9H2,1-4H3 |
| InChIKey | WUSAVIXVOURMMM-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 34.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.36 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|