C16H23F3O4 — CID 123591100
(3R,4S,5S,6R)-5-methoxy-4-[(3R)-2-methyl-3-(4,4,4-trifluoro-3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-ol (PubChem CID 123591100) has the molecular formula C16H23F3O4 and a molecular weight of 336.35 g/mol. Its IUPAC name is (3R,4S,5S,6R)-5-methoxy-4-[(3R)-2-methyl-3-(4,4,4-trifluoro-3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-ol.
| Compound Name | (3R,4S,5S,6R)-5-methoxy-4-[(3R)-2-methyl-3-(4,4,4-trifluoro-3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-ol |
|---|---|
| PubChem CID | 123591100 |
| Molecular Formula | C16H23F3O4 |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | (3R,4S,5S,6R)-5-methoxy-4-[(3R)-2-methyl-3-(4,4,4-trifluoro-3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-ol |
| SMILES | CO[C@@H]1[C@H](O)CC[C@]2(CO2)[C@H]1C1(C)O[C@@H]1CC=C(C)C(F)(F)F |
| InChI | InChI=1S/C16H23F3O4/c1-9(16(17,18)19)4-5-11-14(2,23-11)13-12(21-3)10(20)6-7-15(13)8-22-15/h4,10-13,20H,5-8H2,1-3H3/t10-,11-,12-,13-,14?,15+/m1/s1 |
| InChIKey | VZKMCVJNSWMAEG-BWTKQZKTSA-N |
| XLogP | 2.60 |
| TPSA | 54.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|