C16H25FO4 — CID 123601331
7-fluoro-5-methoxy-4-[2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-ol (PubChem CID 123601331) has the molecular formula C16H25FO4 and a molecular weight of 300.37 g/mol. Its IUPAC name is 7-fluoro-5-methoxy-4-[2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-ol.
| Compound Name | 7-fluoro-5-methoxy-4-[2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-ol |
|---|---|
| PubChem CID | 123601331 |
| Molecular Formula | C16H25FO4 |
| Molecular Weight | 300.37 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | 7-fluoro-5-methoxy-4-[2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-ol |
| SMILES | COC1C(O)C(F)CC2(CO2)C1C1(C)OC1CC=C(C)C |
| InChI | InChI=1S/C16H25FO4/c1-9(2)5-6-11-15(3,21-11)14-13(19-4)12(18)10(17)7-16(14)8-20-16/h5,10-14,18H,6-8H2,1-4H3 |
| InChIKey | VCDSHCQQTQFVCH-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 54.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.37 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|