C22H32IN3O2 — CID 111494733
1-ethyl-2-(2-hydroxy-2,3-diphenylpropyl)-3-(3-methoxypropyl)guanidine;hydroiodide (PubChem CID 111494733) has the molecular formula C22H32IN3O2 and a molecular weight of 497.42 g/mol. Its IUPAC name is 1-ethyl-2-(2-hydroxy-2,3-diphenylpropyl)-3-(3-methoxypropyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-(2-hydroxy-2,3-diphenylpropyl)-3-(3-methoxypropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111494733 |
| Molecular Formula | C22H32IN3O2 |
| Molecular Weight | 497.42 g/mol |
| Exact Mass | 497.15 |
| IUPAC Name | 1-ethyl-2-(2-hydroxy-2,3-diphenylpropyl)-3-(3-methoxypropyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(O)(Cc1ccccc1)c1ccccc1)NCCCOC.I |
| InChI | InChI=1S/C22H31N3O2.HI/c1-3-23-21(24-15-10-16-27-2)25-18-22(26,20-13-8-5-9-14-20)17-19-11-6-4-7-12-19;/h4-9,11-14,26H,3,10,15-18H2,1-2H3,(H2,23,24,25);1H |
| InChIKey | KSYHTUXZIBLEEV-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 65.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.42 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|