C20H32FN5O2 — CID 111497789
2-[4-[N-[2-(4-fluorophenoxy)propyl]-N'-methylcarbamimidoyl]piperazin-1-yl]-N-propan-2-ylacetamide (PubChem CID 111497789) has the molecular formula C20H32FN5O2 and a molecular weight of 393.51 g/mol. Its IUPAC name is 2-[4-[N-[2-(4-fluorophenoxy)propyl]-N'-methylcarbamimidoyl]piperazin-1-yl]-N-propan-2-ylacetamide.
| Compound Name | 2-[4-[N-[2-(4-fluorophenoxy)propyl]-N'-methylcarbamimidoyl]piperazin-1-yl]-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 111497789 |
| Molecular Formula | C20H32FN5O2 |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 393.25 |
| IUPAC Name | 2-[4-[N-[2-(4-fluorophenoxy)propyl]-N'-methylcarbamimidoyl]piperazin-1-yl]-N-propan-2-ylacetamide |
| SMILES | C/N=C(\NCC(C)Oc1ccc(F)cc1)N1CCN(CC(=O)NC(C)C)CC1 |
| InChI | InChI=1S/C20H32FN5O2/c1-15(2)24-19(27)14-25-9-11-26(12-10-25)20(22-4)23-13-16(3)28-18-7-5-17(21)6-8-18/h5-8,15-16H,9-14H2,1-4H3,(H,22,23)(H,24,27) |
| InChIKey | ZZAYGLSACFWTMB-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 69.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|