C15H22FIN4 — CID 111498286
1-butyl-3-[(5-cyano-2-fluorophenyl)methyl]-1,2-dimethylguanidine;hydroiodide (PubChem CID 111498286) has the molecular formula C15H22FIN4 and a molecular weight of 404.27 g/mol. Its IUPAC name is 1-butyl-3-[(5-cyano-2-fluorophenyl)methyl]-1,2-dimethylguanidine;hydroiodide.
| Compound Name | 1-butyl-3-[(5-cyano-2-fluorophenyl)methyl]-1,2-dimethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111498286 |
| Molecular Formula | C15H22FIN4 |
| Molecular Weight | 404.27 g/mol |
| Exact Mass | 404.09 |
| IUPAC Name | 1-butyl-3-[(5-cyano-2-fluorophenyl)methyl]-1,2-dimethylguanidine;hydroiodide |
| SMILES | CCCCN(C)/C(=N\C)NCc1cc(C#N)ccc1F.I |
| InChI | InChI=1S/C15H21FN4.HI/c1-4-5-8-20(3)15(18-2)19-11-13-9-12(10-17)6-7-14(13)16;/h6-7,9H,4-5,8,11H2,1-3H3,(H,18,19);1H |
| InChIKey | SALZKRDLDNSQFR-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 51.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.27 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|