C15H27NO3 — CID 11149886
methyl (2S,6S)-2-[(2R)-2-hydroxypentyl]-6-prop-2-enylpiperidine-1-carboxylate (PubChem CID 11149886) has the molecular formula C15H27NO3 and a molecular weight of 269.38 g/mol. Its IUPAC name is methyl (2S,6S)-2-[(2R)-2-hydroxypentyl]-6-prop-2-enylpiperidine-1-carboxylate.
| Compound Name | methyl (2S,6S)-2-[(2R)-2-hydroxypentyl]-6-prop-2-enylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 11149886 |
| Molecular Formula | C15H27NO3 |
| Molecular Weight | 269.38 g/mol |
| Exact Mass | 269.20 |
| IUPAC Name | methyl (2S,6S)-2-[(2R)-2-hydroxypentyl]-6-prop-2-enylpiperidine-1-carboxylate |
| SMILES | C=CC[C@@H]1CCC[C@@H](C[C@H](O)CCC)N1C(=O)OC |
| InChI | InChI=1S/C15H27NO3/c1-4-7-12-9-6-10-13(11-14(17)8-5-2)16(12)15(18)19-3/h4,12-14,17H,1,5-11H2,2-3H3/t12-,13+,14-/m1/s1 |
| InChIKey | HPSNTETZCLQVCP-HZSPNIEDSA-N |
| XLogP | 3.10 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.38 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|