C10H17NO3 — CID 141291209
(2S,6R)-2-(hydroxymethyl)-6-prop-2-enylpiperidine-1-carboxylic acid (PubChem CID 141291209) has the molecular formula C10H17NO3 and a molecular weight of 199.25 g/mol. Its IUPAC name is (2S,6R)-2-(hydroxymethyl)-6-prop-2-enylpiperidine-1-carboxylic acid.
| Compound Name | (2S,6R)-2-(hydroxymethyl)-6-prop-2-enylpiperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 141291209 |
| Molecular Formula | C10H17NO3 |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.12 |
| IUPAC Name | (2S,6R)-2-(hydroxymethyl)-6-prop-2-enylpiperidine-1-carboxylic acid |
| SMILES | C=CC[C@H]1CCC[C@@H](CO)N1C(=O)O |
| InChI | InChI=1S/C10H17NO3/c1-2-4-8-5-3-6-9(7-12)11(8)10(13)14/h2,8-9,12H,1,3-7H2,(H,13,14)/t8-,9-/m0/s1 |
| InChIKey | IXZOXFFWZDVQGQ-IUCAKERBSA-N |
| XLogP | 1.46 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|