C17H27F3IN5OS — CID 111499910
N-methyl-2-[[N'-methyl-N-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)carbamimidoyl]amino]-N-(2,2,2-trifluoroethyl)acetamide;hydroiodide (PubChem CID 111499910) has the molecular formula C17H27F3IN5OS and a molecular weight of 533.40 g/mol. Its IUPAC name is N-methyl-2-[[N'-methyl-N-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)carbamimidoyl]amino]-N-(2,2,2-trifluoroethyl)acetamide;hydroiodide.
| Compound Name | N-methyl-2-[[N'-methyl-N-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)carbamimidoyl]amino]-N-(2,2,2-trifluoroethyl)acetamide;hydroiodide |
|---|---|
| PubChem CID | 111499910 |
| Molecular Formula | C17H27F3IN5OS |
| Molecular Weight | 533.40 g/mol |
| Exact Mass | 533.09 |
| IUPAC Name | N-methyl-2-[[N'-methyl-N-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)carbamimidoyl]amino]-N-(2,2,2-trifluoroethyl)acetamide;hydroiodide |
| SMILES | C/N=C(\NCC(=O)N(C)CC(F)(F)F)NCC(c1cccs1)N1CCCC1.I |
| InChI | InChI=1S/C17H26F3N5OS.HI/c1-21-16(23-11-15(26)24(2)12-17(18,19)20)22-10-13(14-6-5-9-27-14)25-7-3-4-8-25;/h5-6,9,13H,3-4,7-8,10-12H2,1-2H3,(H2,21,22,23);1H |
| InChIKey | RMOISJJAWXTRTC-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.40 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|