C16H27F3N4O3 — CID 111500123
ethyl 1-[N-ethyl-N'-[2-[methyl(2,2,2-trifluoroethyl)amino]-2-oxoethyl]carbamimidoyl]piperidine-4-carboxylate (PubChem CID 111500123) has the molecular formula C16H27F3N4O3 and a molecular weight of 380.41 g/mol. Its IUPAC name is ethyl 1-[N-ethyl-N'-[2-[methyl(2,2,2-trifluoroethyl)amino]-2-oxoethyl]carbamimidoyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[N-ethyl-N'-[2-[methyl(2,2,2-trifluoroethyl)amino]-2-oxoethyl]carbamimidoyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 111500123 |
| Molecular Formula | C16H27F3N4O3 |
| Molecular Weight | 380.41 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | ethyl 1-[N-ethyl-N'-[2-[methyl(2,2,2-trifluoroethyl)amino]-2-oxoethyl]carbamimidoyl]piperidine-4-carboxylate |
| SMILES | CCN/C(=N\CC(=O)N(C)CC(F)(F)F)N1CCC(C(=O)OCC)CC1 |
| InChI | InChI=1S/C16H27F3N4O3/c1-4-20-15(21-10-13(24)22(3)11-16(17,18)19)23-8-6-12(7-9-23)14(25)26-5-2/h12H,4-11H2,1-3H3,(H,20,21) |
| InChIKey | TWBAFEIGKFUTCP-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 74.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.41 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|