C16H33F3IN5O — CID 111500578
2-[[[2-[di(propan-2-yl)amino]ethylamino]-(ethylamino)methylidene]amino]-N-methyl-N-(2,2,2-trifluoroethyl)acetamide;hydroiodide (PubChem CID 111500578) has the molecular formula C16H33F3IN5O and a molecular weight of 495.37 g/mol. Its IUPAC name is 2-[[[2-[di(propan-2-yl)amino]ethylamino]-(ethylamino)methylidene]amino]-N-methyl-N-(2,2,2-trifluoroethyl)acetamide;hydroiodide.
| Compound Name | 2-[[[2-[di(propan-2-yl)amino]ethylamino]-(ethylamino)methylidene]amino]-N-methyl-N-(2,2,2-trifluoroethyl)acetamide;hydroiodide |
|---|---|
| PubChem CID | 111500578 |
| Molecular Formula | C16H33F3IN5O |
| Molecular Weight | 495.37 g/mol |
| Exact Mass | 495.17 |
| IUPAC Name | 2-[[[2-[di(propan-2-yl)amino]ethylamino]-(ethylamino)methylidene]amino]-N-methyl-N-(2,2,2-trifluoroethyl)acetamide;hydroiodide |
| SMILES | CCN/C(=N\CC(=O)N(C)CC(F)(F)F)NCCN(C(C)C)C(C)C.I |
| InChI | InChI=1S/C16H32F3N5O.HI/c1-7-20-15(21-8-9-24(12(2)3)13(4)5)22-10-14(25)23(6)11-16(17,18)19;/h12-13H,7-11H2,1-6H3,(H2,20,21,22);1H |
| InChIKey | JWAXTQPMDJIPJU-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.37 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|