C19H30F2N4O3 — CID 111501475
N-tert-butyl-2-[[N'-[[2-(difluoromethoxy)-4-methoxyphenyl]methyl]-N-ethylcarbamimidoyl]-methylamino]acetamide (PubChem CID 111501475) has the molecular formula C19H30F2N4O3 and a molecular weight of 400.47 g/mol. Its IUPAC name is N-tert-butyl-2-[[N'-[[2-(difluoromethoxy)-4-methoxyphenyl]methyl]-N-ethylcarbamimidoyl]-methylamino]acetamide.
| Compound Name | N-tert-butyl-2-[[N'-[[2-(difluoromethoxy)-4-methoxyphenyl]methyl]-N-ethylcarbamimidoyl]-methylamino]acetamide |
|---|---|
| PubChem CID | 111501475 |
| Molecular Formula | C19H30F2N4O3 |
| Molecular Weight | 400.47 g/mol |
| Exact Mass | 400.23 |
| IUPAC Name | N-tert-butyl-2-[[N'-[[2-(difluoromethoxy)-4-methoxyphenyl]methyl]-N-ethylcarbamimidoyl]-methylamino]acetamide |
| SMILES | CCN/C(=N\Cc1ccc(OC)cc1OC(F)F)N(C)CC(=O)NC(C)(C)C |
| InChI | InChI=1S/C19H30F2N4O3/c1-7-22-18(25(5)12-16(26)24-19(2,3)4)23-11-13-8-9-14(27-6)10-15(13)28-17(20)21/h8-10,17H,7,11-12H2,1-6H3,(H,22,23)(H,24,26) |
| InChIKey | SHIXIGPNJRZKFD-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.47 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|