C17H26BrFN4O — CID 111977471
2-[[N'-[(4-bromo-2-fluorophenyl)methyl]-N-ethylcarbamimidoyl]-methylamino]-N-tert-butylacetamide (PubChem CID 111977471) has the molecular formula C17H26BrFN4O and a molecular weight of 401.32 g/mol. Its IUPAC name is 2-[[N'-[(4-bromo-2-fluorophenyl)methyl]-N-ethylcarbamimidoyl]-methylamino]-N-tert-butylacetamide.
| Compound Name | 2-[[N'-[(4-bromo-2-fluorophenyl)methyl]-N-ethylcarbamimidoyl]-methylamino]-N-tert-butylacetamide |
|---|---|
| PubChem CID | 111977471 |
| Molecular Formula | C17H26BrFN4O |
| Molecular Weight | 401.32 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | 2-[[N'-[(4-bromo-2-fluorophenyl)methyl]-N-ethylcarbamimidoyl]-methylamino]-N-tert-butylacetamide |
| SMILES | CCN/C(=N\Cc1ccc(Br)cc1F)N(C)CC(=O)NC(C)(C)C |
| InChI | InChI=1S/C17H26BrFN4O/c1-6-20-16(23(5)11-15(24)22-17(2,3)4)21-10-12-7-8-13(18)9-14(12)19/h7-9H,6,10-11H2,1-5H3,(H,20,21)(H,22,24) |
| InChIKey | GIYAGNHUSSJWBL-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.32 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|