C18H25N3O2S — CID 111502621
3-[2-(3-methoxyphenoxy)propyl]-1,2-dimethyl-1-(thiophen-3-ylmethyl)guanidine (PubChem CID 111502621) has the molecular formula C18H25N3O2S and a molecular weight of 347.48 g/mol. Its IUPAC name is 3-[2-(3-methoxyphenoxy)propyl]-1,2-dimethyl-1-(thiophen-3-ylmethyl)guanidine.
| Compound Name | 3-[2-(3-methoxyphenoxy)propyl]-1,2-dimethyl-1-(thiophen-3-ylmethyl)guanidine |
|---|---|
| PubChem CID | 111502621 |
| Molecular Formula | C18H25N3O2S |
| Molecular Weight | 347.48 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | 3-[2-(3-methoxyphenoxy)propyl]-1,2-dimethyl-1-(thiophen-3-ylmethyl)guanidine |
| SMILES | C/N=C(/NCC(C)Oc1cccc(OC)c1)N(C)Cc1ccsc1 |
| InChI | InChI=1S/C18H25N3O2S/c1-14(23-17-7-5-6-16(10-17)22-4)11-20-18(19-2)21(3)12-15-8-9-24-13-15/h5-10,13-14H,11-12H2,1-4H3,(H,19,20) |
| InChIKey | CRBRCVVUYZAYJF-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 46.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.48 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|